CymitQuimica logo

CAS 325786-24-1

:

Benzoic acid, 5-borono-2-chloro-4-fluoro-, 1-methyl ester

Description:
Benzoic acid, 5-borono-2-chloro-4-fluoro-, 1-methyl ester is a chemical compound characterized by its unique functional groups and structural features. It contains a benzoic acid moiety, which is a carboxylic acid derivative, indicating it has acidic properties. The presence of a boron atom suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions. The chlorine and fluorine substituents on the aromatic ring contribute to its reactivity and may influence its electronic properties, making it useful in various synthetic applications. The methyl ester group indicates that the compound is an ester, which typically enhances its solubility in organic solvents and may affect its reactivity compared to the parent acid. Overall, this compound is of interest in medicinal chemistry and materials science due to its potential as a building block in the synthesis of more complex molecules. Its specific applications would depend on the reactivity of the functional groups and the overall molecular structure.
Formula:C8H7BClFO4
InChI:InChI=1S/C8H7BClFO4/c1-15-8(12)4-2-5(9(13)14)7(11)3-6(4)10/h2-3,13-14H,1H3
InChI key:InChIKey=XKBKUIKMZBFWFF-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(B(O)O)=C(F)C=C1Cl
Synonyms:
  • Benzoic acid, 5-borono-2-chloro-4-fluoro-, 1-methyl ester
  • 4-Chloro-2-fluoro-5-methoxycarbonylphenylboronic acid
Found 2 products.