CymitQuimica logo

CAS 325851-81-8

:

3-{[(3R,4R)-4-hydroxy-1,1-dioxidotetrahydrothiophen-3-yl]ammonio}propanoate

Description:
3-{[(3R,4R)-4-hydroxy-1,1-dioxidotetrahydrothiophen-3-yl]ammonio}propanoate, with CAS number 325851-81-8, is a chemical compound characterized by its unique structure that includes a tetrahydrothiophene ring with hydroxyl and ammonium functional groups. This compound is likely to exhibit properties typical of ammonium salts, such as solubility in water and potential bioactivity due to its functional groups. The presence of the hydroxy group suggests it may participate in hydrogen bonding, influencing its reactivity and interactions with biological systems. The tetrahydrothiophene moiety may contribute to its stability and potential pharmacological properties. Additionally, the propanoate part of the molecule indicates that it may act as a zwitterion, which can affect its solubility and interaction with other molecules. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and materials science, where its unique structural features could be leveraged for specific applications.
Formula:C7H13NO5S
InChI:InChI=1/C7H13NO5S/c9-6-4-14(12,13)3-5(6)8-2-1-7(10)11/h5-6,8-9H,1-4H2,(H,10,11)/t5-,6-/m0/s1
InChI key:NXYDPTKVWOEPPC-UHFFFAOYSA-N
SMILES:C(CN[C@H]1CS(=O)(=O)C[C@@H]1O)C(=O)O
Found 1 products.