CymitQuimica logo

CAS 326-33-0

:

4-fluoroacetophenone semicarbazone

Description:
4-Fluoroacetophenone semicarbazone is an organic compound derived from the reaction of 4-fluoroacetophenone with semicarbazide. It is characterized by the presence of a semicarbazone functional group, which is formed through the condensation of a carbonyl compound and a semicarbazide. This compound typically appears as a crystalline solid and is known for its role in various chemical reactions, particularly in the synthesis of other organic compounds. It exhibits moderate solubility in polar solvents, which is common for semicarbazones due to their ability to form hydrogen bonds. The presence of the fluorine atom in the aromatic ring can influence the compound's reactivity and physical properties, such as melting point and boiling point. 4-Fluoroacetophenone semicarbazone may also exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity and reactivity.
Formula:C9H10FN3O
InChI:InChI=1S/C9H10FN3O/c1-6(12-13-9(11)14)7-2-4-8(10)5-3-7/h2-5H,1H3,(H3,11,13,14)/b12-6+
InChI key:ZYYTYSQJWLDRSR-WUXMJOGZSA-N
SMILES:C/C(=N\NC(=O)N)/C1=CC=C(C=C1)F
Synonyms:
  • Hydrazinecarboxamide, 2-[1-(4-fluorophenyl)ethylidene]-
  • 4-fluoroacetophenone semicarbazone
Found 3 products.