CAS 3260-49-9
:4,6-dihydroxy-1-benzofuran-3(2H)-one
Description:
4,6-Dihydroxy-1-benzofuran-3(2H)-one, also known as 4,6-dihydroxycoumarin, is a chemical compound characterized by its benzofuran structure, which features a fused benzene and furan ring. This compound contains two hydroxyl (-OH) groups at the 4 and 6 positions, contributing to its reactivity and potential biological activity. It typically appears as a crystalline solid and is soluble in polar solvents like water and alcohols. The presence of hydroxyl groups enhances its ability to form hydrogen bonds, influencing its solubility and interaction with other molecules. 4,6-Dihydroxy-1-benzofuran-3(2H)-one is of interest in various fields, including medicinal chemistry, due to its potential antioxidant and anti-inflammatory properties. Its structural features may also allow it to act as a precursor in the synthesis of other organic compounds. As with many phenolic compounds, it may exhibit a range of biological activities, making it a subject of research in pharmacology and biochemistry.
Formula:C8H6O4
InChI:InChI=1/C8H6O4/c9-4-1-5(10)8-6(11)3-12-7(8)2-4/h1-2,9-10H,3H2
SMILES:c1c(cc2c(c1O)C(=O)CO2)O
Synonyms:- 3(2H)-benzofuranone, 4,6-dihydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
