CymitQuimica logo

CAS 3260-78-4

:

5-Bromo-benzofuran-3-one

Description:
5-Bromo-benzofuran-3-one is an organic compound characterized by its unique structure, which includes a benzofuran moiety substituted with a bromine atom at the 5-position and a carbonyl group at the 3-position. This compound typically appears as a solid and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical reactions, including electrophilic substitutions and coupling reactions. The carbonyl group contributes to its ability to participate in nucleophilic addition reactions. Additionally, benzofuran derivatives are often studied for their biological activities, including antimicrobial and anti-inflammatory properties. The compound's solubility can vary depending on the solvent, and it is generally handled with care due to the presence of bromine, which can be hazardous. Overall, 5-Bromo-benzofuran-3-one is a valuable compound in the field of organic chemistry, with diverse applications in research and industry.
Formula:C8H5ClO2
InChI:InChI=1/C8H5ClO2/c9-5-1-2-6-7(10)4-11-8(6)3-5/h1-3H,4H2
InChI key:QSYZLDHZMYWEKL-UHFFFAOYSA-N
SMILES:c1cc2C(=O)COc2cc1Cl
Synonyms:
  • 3(2H)-benzofuranone, 5-bromo-
  • 5-Brom-1-benzofuran-3(2H)-on
  • 5-Bromo-1-benzofuran-3(2H)-one
  • 5-Bromo-3-Benzofuranone
Found 4 products.