CymitQuimica logo

CAS 326015-55-8

:

((2,3-DIMETHYL-5-OXO-1-PHENYL(3-PYRAZOLIN-4-YL))AMINO)-N-((4-METHYLPHENYL)SULFONYL)FORMAMIDE

Description:
The chemical substance known as ((2,3-Dimethyl-5-oxo-1-phenyl(3-pyrazolin-4-yl))amino)-N-((4-methylphenyl)sulfonyl)formamide, with CAS number 326015-55-8, is a complex organic compound characterized by its unique structural features. It contains a pyrazoline ring, which is a five-membered heterocyclic compound known for its potential biological activity. The presence of a sulfonamide group indicates that it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. The dimethyl and phenyl substituents contribute to its lipophilicity and may influence its interaction with biological targets. Additionally, the oxo and amino functional groups suggest potential reactivity and the ability to form hydrogen bonds, which are crucial for biological activity. Overall, this compound's intricate structure may confer specific pharmacological properties, making it a subject of interest in drug discovery and development. Further studies would be necessary to elucidate its biological effects and potential applications.
Formula:C19H20N4O4S
InChI:InChI=1S/C19H20N4O4S/c1-13-9-11-16(12-10-13)28(26,27)21-19(25)20-17-14(2)22(3)23(18(17)24)15-7-5-4-6-8-15/h4-12H,1-3H3,(H2,20,21,25)
InChI key:HMSLLBOGVWHAAM-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=C(N(N(C2=O)C3=CC=CC=C3)C)C
Synonyms:
  • ((2,3-DIMETHYL-5-OXO-1-PHENYL(3-PYRAZOLIN-4-YL))AMINO)-N-((4-METHYLPHENYL)SULFONYL)FORMAMIDE
  • 3-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-1-(4-methylbenzenesulfonyl)urea
Found 1 products.