CymitQuimica logo

CAS 326023-22-7

:

4-Chloro-3-[[(2-chlorophenyl)amino]sulfonyl]benzoic acid

Description:
4-Chloro-3-[[(2-chlorophenyl)amino]sulfonyl]benzoic acid, with the CAS number 326023-22-7, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a sulfonamide group and a chlorophenyl amine. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals due to its sulfonamide functionality, which is known for its biological activity. The presence of chlorine atoms in its structure may influence its reactivity and solubility in different solvents. Additionally, the compound's sulfonyl group can enhance its interaction with biological targets, making it of interest in medicinal chemistry. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks or environmental hazards.
Formula:C13H9Cl2NO4S
InChI:InChI=1S/C13H9Cl2NO4S/c14-9-3-1-2-4-11(9)16-21(19,20)12-7-8(13(17)18)5-6-10(12)15/h1-7,16H,(H,17,18)
InChI key:InChIKey=XDUFELBTIZCYDJ-UHFFFAOYSA-N
SMILES:S(NC1=C(Cl)C=CC=C1)(=O)(=O)C2=CC(C(O)=O)=CC=C2Cl
Synonyms:
  • 4-Chloro-3-[[(2-chlorophenyl)amino]sulfonyl]benzoic acid
  • Benzoic acid, 4-chloro-3-[[(2-chlorophenyl)amino]sulfonyl]-
Found 1 products.