CAS 32609-19-1

N-[[(3-Hydroxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-yl)amino]carbonyl]-4-methylbenzenesulfonamide

Description:

N-[[(3-Hydroxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-yl)amino]carbonyl]-4-methylbenzenesulfonamide, with CAS number 32609-19-1, is a chemical compound characterized by its complex structure, which includes a bicyclic framework and functional groups such as an amino group, a carbonyl group, and a sulfonamide moiety. This compound is typically a solid at room temperature and exhibits moderate solubility in polar solvents due to the presence of hydroxyl and sulfonamide groups, which can engage in hydrogen bonding. Its bicyclic structure contributes to its unique steric and electronic properties, potentially influencing its biological activity. The sulfonamide group is known for its role in medicinal chemistry, often associated with antibacterial properties. The compound may also exhibit specific reactivity patterns due to the presence of the carbonyl and amino functionalities, making it of interest in various synthetic and pharmaceutical applications. Overall, its distinct structural features and functional groups suggest potential utility in drug development and other chemical applications.

Formula: C₁₈H₂₆N₂O₄S

InChI: InChI=1S/C18H26N2O4S/c1-11-5-7-12(8-6-11)25(23,24)20-16(22)19-14-13-9-10-18(4,15(14)21)17(13,2)3/h5-8,13-15,21H,9-10H2,1-4H3,(H2,19,20,22)

InChI key: InChIKey=RMTYNAPTNBJHQI-UHFFFAOYSA-N

SMILES: CC12C(C)(C)C(C(NC(NS(=O)(=O)C3=CC=C(C)C=C3)=O)C1O)CC2

Synonyms:

• Urea, 1-(2-hydroxy-3-bornyl)-3-(p-tolylsulfonyl)-
• Benzenesulfonamide, N-[[(3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-yl)amino]carbonyl]-4-methyl-
• N-[[(3-Hydroxy-4,7,7-trimethylbicyclo[2.2.1]hept-2-yl)amino]carbonyl]-4-methylbenzenesulfonamide

Glibornuride (Mixture of Diastereomers)

CAS: 32609-19-1

Formula: C₁₈H₂₆N₂O₄S

Color and Shape: White To Off-White Solid

Molecular weight: 366.48

Ref: 4Z-G-171