CymitQuimica logo

CAS 326102-27-6

:

[(8-chloro-4-oxo-1,2,3,4-tetrahydrocyclopenta[c]chromen-7-yl)oxy]acetic acid

Description:
The chemical substance known as [(8-chloro-4-oxo-1,2,3,4-tetrahydrocyclopenta[c]chromen-7-yl)oxy]acetic acid, with the CAS number 326102-27-6, is characterized by its complex molecular structure, which includes a chromene core fused with a cyclopentane ring. This compound features a chloro substituent and a keto group, contributing to its reactivity and potential biological activity. The presence of the oxyacetic acid moiety suggests that it may exhibit acidic properties, allowing for interactions with various biological targets. Its unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, particularly the chloro and carboxylic acid functionalities. As with many synthetic organic compounds, its applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and interaction with other molecules. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C14H11ClO5
InChI:InChI=1/C14H11ClO5/c15-10-4-9-7-2-1-3-8(7)14(18)20-11(9)5-12(10)19-6-13(16)17/h4-5H,1-3,6H2,(H,16,17)
InChI key:XAVICLHQMPREMA-UHFFFAOYSA-N
SMILES:C1Cc2c(C1)c(=O)oc1cc(c(cc21)Cl)OCC(=O)O
Synonyms:
  • Acetic acid, 2-[(8-chloro-1,2,3,4-tetrahydro-4-oxobenzo[b]cyclopenta[d]pyran-7-yl)oxy]-
  • [(8-Chloro-4-oxo-1,2,3,4-tetrahydrocyclopenta[c]chromen-7-yl)oxy]acetic acid
Found 1 products.