CymitQuimica logo

CAS 3262-64-4

:

(L)-3-(Propargylsulfenyl)-alanine

Description:
(L)-3-(Propargylsulfenyl)-alanine, identified by its CAS number 3262-64-4, is an amino acid derivative characterized by the presence of a propargylsulfenyl group attached to the alpha carbon of the alanine backbone. This compound features a propargyl group, which is a three-carbon alkyne, contributing to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The sulfenyl moiety introduces a sulfur atom, which can participate in various chemical reactions, including nucleophilic substitutions and redox processes. The stereochemistry of the molecule is specified as (L), indicating that it is the levorotatory form, which is relevant for biological activity and interactions with enzymes and receptors. This compound may exhibit interesting properties such as antimicrobial or anticancer activity, making it a subject of interest in pharmaceutical research. Its structural characteristics and functional groups allow for potential modifications and derivatizations, expanding its utility in synthetic chemistry and biochemistry.
Formula:C6H9NO2S
InChI:InChI=1/C6H9NO2S/c1-2-3-10-4-5(7)6(8)9/h1,5H,3-4,7H2,(H,8,9)/t5-/m0/s1
InChI key:JAKVEOCMEMGHGB-YFKPBYRVSA-N
SMILES:C#CCSC[C@@H](C(=O)O)N
Synonyms:
  • (R)-2-Amino-3-(2-propynylthio)propanoic acid
  • S-prop-2-yn-1-yl-L-cysteine
Found 5 products.