CymitQuimica logo

CAS 32620-61-4

:

2-(2-Furanylmethyl)-1H-pyrrole-2,5-dione

Description:
2-(2-Furanylmethyl)-1H-pyrrole-2,5-dione, with the CAS number 32620-61-4, is an organic compound characterized by its unique structure that combines a pyrrole ring with a furan moiety. This compound typically exhibits a yellow to brown color and is known for its potential biological activities, including antioxidant and antimicrobial properties. The presence of the furan and pyrrole rings contributes to its reactivity, making it a subject of interest in synthetic organic chemistry and medicinal chemistry. It is soluble in organic solvents, which enhances its applicability in various chemical reactions and formulations. Additionally, the compound may participate in various chemical transformations, such as cycloadditions and substitutions, due to the electron-rich nature of the furan and the electrophilic character of the pyrrole. Its derivatives and analogs are often explored for their potential therapeutic applications, particularly in the development of new pharmaceuticals. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C9H7NO3
InChI:InChI=1/C9H7NO3/c11-8-3-4-9(12)10(8)6-7-2-1-5-13-7/h1-5H,6H2
SMILES:c1cc(CN2C(=O)C=CC2=O)oc1
Synonyms:
  • 1-(furan-2-ylmethyl)-1H-pyrrole-2,5-dione
Found 1 products.