CymitQuimica logo

CAS 3263-79-4

:

2,3,4,5-Tetraphenyl-1H-pyrrole

Description:
2,3,4,5-Tetraphenyl-1H-pyrrole is an organic compound characterized by its distinctive pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features four phenyl groups attached to the pyrrole ring, contributing to its stability and unique electronic properties. It is typically a solid at room temperature and exhibits a high degree of thermal stability due to the delocalization of electrons across the phenyl groups and the pyrrole ring. The presence of multiple phenyl substituents enhances its solubility in organic solvents and can influence its optical properties, making it of interest in various applications, including organic electronics and materials science. Additionally, 2,3,4,5-tetraphenyl-1H-pyrrole can participate in various chemical reactions, such as oxidation and polymerization, which further expands its utility in synthetic chemistry. Its structural characteristics and reactivity make it a valuable compound for research in organic synthesis and materials development.
Formula:C28H21N
InChI:InChI=1S/C28H21N/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)28(24-19-11-4-12-20-24)29-27(25)23-17-9-3-10-18-23/h1-20,29H
InChI key:InChIKey=IEZVMRGFNUNABR-UHFFFAOYSA-N
SMILES:C=1(C(=C(NC1C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5
Synonyms:
  • 2,3,4,5-Tetraphenyl-1H-pyrrole
  • Tetraphenylpyrrole
  • 2,3,4,5-Tetraphenylpyrrole
  • Pyrrole, 2,3,4,5-tetraphenyl-
  • 1H-Pyrrole, 2,3,4,5-tetraphenyl-
Found 2 products.