CymitQuimica logo

CAS 32640-96-3

:

4,4,6-triMethyl-1,2,3,4-tetrahydroquinoline

Description:
4,4,6-Trimethyl-1,2,3,4-tetrahydroquinoline is a bicyclic organic compound characterized by its unique structure, which includes a quinoline ring system that is partially saturated. This compound features three methyl groups at the 4 and 6 positions of the tetrahydroquinoline framework, contributing to its steric and electronic properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the tetrahydro structure imparts certain reactivity, making it a potential candidate for various chemical reactions, including those involving nucleophilic substitutions or cyclizations. Its molecular structure suggests potential applications in organic synthesis, pharmaceuticals, and as a building block in the development of more complex molecules. Additionally, the compound may exhibit interesting biological activities, although specific data on its pharmacological properties may vary. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C12H17N
InChI:InChI=1S/C12H17N/c1-9-4-5-11-10(8-9)12(2,3)6-7-13-11/h4-5,8,13H,6-7H2,1-3H3
InChI key:RDKAHMCUWYYTGY-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1)NCCC2(C)C
Synonyms:
  • Quinoline, 1,2,3,4-tetrahydro-4,4,6-triMethyl-
  • 1,2,3,4-tetrahydro-4,4,6-trimethylquinoline
  • 4,4,6-Trimethyl-2,3-dihydro-1H-quinoline
  • 4,4,6-triMethyl-1,2,3,4-tetrahydroquinoline
Found 4 products.