CymitQuimica logo

CAS 326477-70-7

:

copper(1+) 2-hydroxy-3-methylbenzoate

Description:
Copper(1+) 2-hydroxy-3-methylbenzoate, also known as copper salicylate, is a coordination compound featuring copper in its +1 oxidation state complexed with the anion derived from 2-hydroxy-3-methylbenzoic acid. This compound typically exhibits a bright blue or green color, characteristic of many copper complexes, due to d-d electronic transitions. It is soluble in organic solvents and may have limited solubility in water, depending on the specific conditions. The presence of the hydroxyl group in the salicylate moiety contributes to its potential chelating properties, allowing it to form stable complexes with various metal ions. This compound may exhibit biological activity, including antimicrobial properties, making it of interest in medicinal chemistry and materials science. Additionally, its coordination chemistry can lead to interesting applications in catalysis and as a precursor for other copper-based materials. Safety data should be consulted, as copper compounds can be toxic in certain concentrations.
Formula:C8H7CuO3
InChI:InChI=1/C8H8O3.Cu/c1-5-3-2-4-6(7(5)9)8(10)11;/h2-4,9H,1H3,(H,10,11);/q;+1/p-1
InChI key:CPPQOSMKJDPRID-UHFFFAOYSA-M
SMILES:Cc1cccc(c1O)C(=O)O.[Cu]
Synonyms:
  • Benzoic acid, 2-hydroxy-3-methyl-, copper(1+) salt (1:1)
Found 4 products.