CymitQuimica logo

CAS 326496-51-9

:

{4-[(acetyloxy)methyl]phenyl}boronic acid

Description:
{4-[(Acetyloxy)methyl]phenyl}boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has an acetyloxy methyl substituent. This compound typically exhibits properties such as being a white to off-white solid at room temperature, with solubility in polar solvents like water and alcohols due to the boronic acid group. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and as a reagent in chemical biology for the detection of sugars. The presence of the acetyloxy group can influence its reactivity and stability, potentially enhancing its solubility and facilitating specific chemical reactions. Additionally, boronic acids are often utilized in Suzuki coupling reactions, which are important for the formation of carbon-carbon bonds in organic synthesis. Overall, this compound is significant in both academic research and industrial applications due to its versatile reactivity and functional properties.
Formula:C9H11BO4
InChI:InChI=1/C9H11BO4/c1-7(11)14-6-8-2-4-9(5-3-8)10(12)13/h2-5,12-13H,6H2,1H3
InChI key:FPQABEOUQSYDPY-UHFFFAOYSA-N
SMILES:CC(=O)OCc1ccc(cc1)B(O)O
Synonyms:
  • (4-(Acetoxymethyl)phenyl)boronicacid
Found 4 products.