CymitQuimica logo

CAS 3265-16-5

:

2H-Indol-2-one, 3-(1,2-dihydro-1-methyl-2-oxo-3H-indol-3-ylidene)-1,3-dihydro-1-methyl-

Description:
2H-Indol-2-one, 3-(1,2-dihydro-1-methyl-2-oxo-3H-indol-3-ylidene)-1,3-dihydro-1-methyl- is a complex organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features multiple functional groups, including a ketone and an imine, contributing to its reactivity and potential biological activity. The presence of the indole moiety suggests that it may exhibit properties relevant to pharmaceuticals, as indole derivatives are often found in various bioactive compounds. The compound's molecular structure indicates it may participate in hydrogen bonding and π-π stacking interactions, which are significant in biological systems. Additionally, its molecular weight and solubility characteristics would influence its behavior in different solvents and biological environments. Overall, this compound's unique structural features may render it of interest in medicinal chemistry and materials science, although specific applications would depend on further research into its properties and interactions.
Formula:C18H14N2O2
InChI:InChI=1S/C18H14N2O2/c1-19-13-9-5-3-7-11(13)15(17(19)21)16-12-8-4-6-10-14(12)20(2)18(16)22/h3-10H,1-2H3/b16-15+
InChI key:MNGMWQPXNIONLF-FOCLMDBBSA-N
SMILES:CN1C2=CC=CC=C2/C(=C\3/C4=CC=CC=C4N(C3=O)C)/C1=O
Synonyms:
  • 1,1'-Dimethyl-[3,3'-biindolinylidene]-2,2'-dione
  • 2H-Indol-2-one, 3-(1,2-dihydro-1-methyl-2-oxo-3H-indol-3-ylidene)-1,3-dihydro-1-methyl-
Found 3 products.