CymitQuimica logo

CAS 3265-71-2

:

Ethyl 2-methyl-4,5,6,7-tetrafluorobenzofuran-3-carboxylate

Description:
Ethyl 2-methyl-4,5,6,7-tetrafluorobenzofuran-3-carboxylate, with the CAS number 3265-71-2, is a synthetic organic compound characterized by its complex structure, which includes a benzofuran moiety and multiple fluorine substituents. This compound typically exhibits a high degree of lipophilicity due to the presence of fluorine atoms, which can enhance its biological activity and stability. The ethyl ester functional group contributes to its solubility in organic solvents, making it useful in various chemical applications. The presence of the methyl group and the tetrafluorinated benzofuran structure may impart unique electronic properties, potentially influencing its reactivity and interaction with biological systems. Additionally, compounds like this one are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed due to the presence of fluorinated components, which can pose environmental and health risks.
Formula:C12H8F4O3
InChI:InChI=1/C12H8F4O3/c1-3-18-12(17)5-4(2)19-11-6(5)7(13)8(14)9(15)10(11)16/h3H2,1-2H3
InChI key:FLVYOTVMIFECHQ-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c(C)oc2c1c(c(c(c2F)F)F)F
Synonyms:
  • Ethyl 4,5,6,7-tetrafluoro-2-methylbenzo[b]furan-3-carboxylate
  • Ethyl 4,5,6,7-Tetrafluoro-2-Methyl-1-Benzofuran-3-Carboxylate
Found 2 products.