CAS 3265-72-3

4,5,6,7-Tetrafluoro-2-methyl-3-benzofurancarboxylic acid

Description:

4,5,6,7-Tetrafluoro-2-methyl-3-benzofurancarboxylic acid is a fluorinated organic compound characterized by the presence of four fluorine atoms, a methyl group, and a carboxylic acid functional group attached to a benzofuran ring system. This compound exhibits unique chemical properties due to the electronegative fluorine atoms, which can influence its reactivity, polarity, and solubility. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may act as a weak acid. The fluorine substituents can enhance the compound's stability and alter its interaction with biological systems, making it of interest in pharmaceuticals and agrochemicals. Additionally, the benzofuran structure contributes to its aromatic characteristics, potentially affecting its electronic properties and reactivity. Overall, this compound's unique structure and functional groups make it a subject of interest in various chemical research fields, including materials science and medicinal chemistry.

Formula: C₁₀H₄F₄O₃

InChI: InChI=1S/C10H4F4O3/c1-2-3(10(15)16)4-5(11)6(12)7(13)8(14)9(4)17-2/h1H3,(H,15,16)

InChI key: InChIKey=PCQIMPCKDMEBLS-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(OC1C)=C(F)C(F)=C(F)C2F

Synonyms:

• 4,5,6,7-Tetrafluoro-2-methyl-3-benzofurancarboxylic acid
• 3-Benzofurancarboxylic acid, 4,5,6,7-tetrafluoro-2-methyl-

4,5,6,7-Tetrafluoro-2-methylbenzofuran-3-carboxylic acid

CAS: 3265-72-3

Formula: C₁₀H₄F₄O₃

Molecular weight: 248.1306

Ref: IN-DA00CZIH