CymitQuimica logo

CAS 32650-62-7

:

Propanoic acid, 3,3,3-triethoxy-, ethyl ester

Description:
Propanoic acid, 3,3,3-triethoxy-, ethyl ester, with the CAS number 32650-62-7, is an organic compound characterized by its ester functional group. It is derived from propanoic acid, where three ethoxy groups are attached to the carbon chain, enhancing its solubility in organic solvents. This compound typically exhibits a moderate boiling point and is likely to be a colorless to pale yellow liquid at room temperature. Its structure suggests it may have applications in organic synthesis, potentially serving as a reagent or intermediate in the production of other chemical compounds. The presence of multiple ethoxy groups can influence its reactivity, making it less polar compared to other carboxylic acid derivatives. Additionally, it may possess mild odor characteristics typical of esters. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken due to potential irritant properties. Overall, this compound's unique structure and properties make it of interest in various chemical applications.
Formula:C11H22O5
InChI:InChI=1S/C11H22O5/c1-5-13-10(12)9-11(14-6-2,15-7-3)16-8-4/h5-9H2,1-4H3
InChI key:PIVYSIAHRZAYMK-UHFFFAOYSA-N
SMILES:CCOC(=O)CC(OCC)(OCC)OCC
Found 2 products.