CymitQuimica logo

CAS 32653-37-5

:

(S)-2-Bromo-3,3-dimethylbutanoic acid

Description:
(S)-2-Bromo-3,3-dimethylbutanoic acid is a chiral organic compound characterized by its bromine substituent and branched alkyl structure. It features a carboxylic acid functional group, which imparts acidic properties to the molecule. The presence of the bromine atom at the second carbon position contributes to its reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The three methyl groups attached to the third carbon create steric hindrance, influencing the compound's physical and chemical properties, such as solubility and boiling point. As a chiral molecule, it exists in two enantiomeric forms, with the (S)-configuration being one of them, which can exhibit different biological activities compared to its (R)-counterpart. This compound is often utilized in the synthesis of pharmaceuticals and agrochemicals, where chirality plays a crucial role in the efficacy and safety of the final products. Proper handling and storage are essential due to its potential reactivity and the presence of bromine, which can pose health risks.
Formula:C6H11BrO2
InChI:InChI=1/C6H11BrO2/c1-6(2,3)4(7)5(8)9/h4H,1-3H3,(H,8,9)/t4-/m1/s1
InChI key:MJLVLHNXEOQASX-SCSAIBSYSA-N
SMILES:CC(C)(C)[C@@H](C(=O)O)Br
Synonyms:
  • (S)-2-Bromo-3,3-dimethylbutyric acid
  • (2S)-2-bromo-3,3-dimethyl-butanoic acid
Found 1 products.