CAS 32654-40-3

3-methylpyridin-2-amine hydrochloride

Description:

3-Methylpyridin-2-amine hydrochloride, with the CAS number 32654-40-3, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl group and an amino group attached to the pyridine ring, specifically at the 3 and 2 positions, respectively. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water. The presence of the amino group imparts basic properties to the compound, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The compound's properties, such as melting point, solubility, and reactivity, can vary based on its specific formulation and purity. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₆H₉ClN₂

InChI: InChI=1/C6H8N2.ClH/c1-5-3-2-4-8-6(5)7;/h2-4H,1H3,(H2,7,8);1H

InChI key: TWPWGZCCJIAXOF-UHFFFAOYSA-N

SMILES: Cc1cccnc1N.Cl

3-Methylpyridin-2-amine hydrochloride

CAS: 32654-40-3

Formula: C₆H₉ClN₂

Molecular weight: 144.6021

Ref: IN-DA00BYX9