CymitQuimica logo

CAS 32658-54-1

:

2,5-pyridinedicarboxylic acid N-oxide

Description:
2,5-Pyridinedicarboxylic acid N-oxide, identified by its CAS number 32658-54-1, is a heterocyclic organic compound featuring a pyridine ring with two carboxylic acid groups at the 2 and 5 positions, along with an N-oxide functional group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid groups, which can engage in hydrogen bonding. The N-oxide functionality enhances its reactivity and can influence its biological activity, making it of interest in various chemical and pharmaceutical applications. The presence of multiple functional groups allows for diverse chemical reactivity, including potential roles in coordination chemistry and as intermediates in organic synthesis. Additionally, the compound may exhibit specific properties such as acidity due to the carboxylic acid groups, and its stability can be influenced by environmental factors such as pH and temperature. Overall, 2,5-pyridinedicarboxylic acid N-oxide is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C7H5NO5
InChI:InChI=1S/C7H5NO5/c9-6(10)4-1-2-5(7(11)12)8(13)3-4/h1-3H,(H,9,10)(H,11,12)
InChI key:GSYUIHFCQJNUMT-UHFFFAOYSA-N
SMILES:C1=CC(=[N+](C=C1C(=O)O)[O-])C(=O)O
Synonyms:
  • 2,5-Dicarboxypyridine 1-oxide
  • 1-OXIDOPYRIDIN-1-IUM-2,5-DICARBOXYLIC ACID
  • 2,5-pyridinedicarboxylic acid N-oxide
  • 2,5-Pyridinedicarboxylic acid, 1-oxide
Found 3 products.