CAS 32676-16-7

4-(prop-1-en-2-yl)cyclohexanecarboxylic acid

Description:

4-(Prop-1-en-2-yl)cyclohexanecarboxylic acid, identified by its CAS number 32676-16-7, is an organic compound characterized by a cyclohexane ring substituted with a carboxylic acid group and a prop-1-en-2-yl group. This compound features a double bond in the prop-1-en-2-yl side chain, which contributes to its reactivity and potential for polymerization. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The cyclohexane structure provides a stable, saturated backbone, while the unsaturation in the side chain can lead to unique stereochemical configurations. This compound may be utilized in organic synthesis, particularly in the development of more complex molecules or as a building block in materials science. Its physical properties, such as solubility and melting point, would depend on the specific conditions and purity of the sample. Overall, 4-(prop-1-en-2-yl)cyclohexanecarboxylic acid is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₀H₁₆O₂

InChI: InChI=1/C10H16O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h8-9H,1,3-6H2,2H3,(H,11,12)

InChI key: XZOBEDLKVOHSSH-UHFFFAOYSA-N

SMILES: C=C(C)C1CCC(CC1)C(=O)O

Synonyms:

• 4-(1-Methylethenyl)cyclohexane-1-carboxylic acid
• Cyclohexanecarboxylic acid, 4-(1-methylethenyl)-

1,2-Dihydroperillic Acid

Controlled Product

CAS: 32676-16-7

Applications 1,2-Dihydroperillic Acid is a compound being used in phase I studies for treatment of cancer patients.
References Murren, J.R., et al.: Cancer Biol. Ther., 1, 130-135 (2002)

Formula: C₁₀H₁₆O₂

Color and Shape: Neat

Molecular weight: 168.23

Ref: TR-D454688