CymitQuimica logo

CAS 326829-08-7

:

Isoxazole, 3-chloro-4,5-dihydro-5,5-dimethyl-

Description:
Isoxazole, 3-chloro-4,5-dihydro-5,5-dimethyl- is a heterocyclic organic compound characterized by the presence of an isoxazole ring, which consists of a five-membered ring containing three carbon atoms, one nitrogen atom, and one oxygen atom. The compound features a chlorine substituent at the 3-position and two methyl groups at the 5-position of the isoxazole ring, contributing to its unique chemical properties. The dihydro configuration indicates that the compound has two additional hydrogen atoms, suggesting it is a saturated derivative of isoxazole. This structure can influence its reactivity and interactions with other chemical species. Isoxazoles are known for their biological activity and can serve as intermediates in the synthesis of pharmaceuticals and agrochemicals. The presence of the chlorine atom may enhance its lipophilicity and alter its biological activity. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and materials science.
Formula:C5H8ClNO
InChI:InChI=1S/C5H8ClNO/c1-5(2)3-4(6)7-8-5/h3H2,1-2H3
InChI key:YMCWJQIZJIKFHO-UHFFFAOYSA-N
SMILES:CC1(CC(=NO1)Cl)C
Synonyms:
  • 3-chloro-5,5-dimethyl-4,5-dihydroisoxazol
Found 5 products.