CymitQuimica logo

CAS 32683-00-4

:

ethyl 2-phenyl-1H-imidazole-5-carboxylate

Description:
Ethyl 2-phenyl-1H-imidazole-5-carboxylate is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of the phenyl group enhances its aromatic characteristics and may influence its reactivity and interaction with biological systems. Typically, compounds like this can exhibit various biological activities, making them of interest in medicinal chemistry. The carboxylate group can participate in hydrogen bonding and other interactions, which may affect the compound's properties, such as melting point, boiling point, and solubility. Additionally, the compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many imidazole derivatives, it may also exhibit properties such as antifungal or antibacterial activity, although specific biological data would be necessary to confirm these effects. Overall, ethyl 2-phenyl-1H-imidazole-5-carboxylate is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C12H12N2O2
InChI:InChI=1/C12H12N2O2/c1-2-16-12(15)10-8-13-11(14-10)9-6-4-3-5-7-9/h3-8H,2H2,1H3,(H,13,14)
InChI key:UABZXMAUPKBULM-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cnc(c2ccccc2)[nH]1
Found 3 products.