CAS 32683-07-1

N-(Iminophenylmethyl)glycine

Description:

N-(Iminophenylmethyl)glycine, with the CAS number 32683-07-1, is an organic compound characterized by its structure, which includes an iminophenyl group attached to a glycine moiety. This compound typically exhibits properties associated with both amino acids and aromatic compounds, making it of interest in various chemical and biological applications. It is likely to be a white to off-white solid, soluble in polar solvents due to the presence of the amino and carboxylic acid functional groups. The compound may display biological activity, potentially acting as a ligand or a precursor in synthetic pathways. Its structure suggests it could participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and solubility. Additionally, the presence of the iminophenyl group may impart unique electronic properties, making it suitable for studies in medicinal chemistry or materials science. As with any chemical substance, safety data should be consulted to understand its handling and potential hazards.

Formula: C₉H₁₀N₂O₂

InChI: InChI=1/C9H10N2O2/c10-9(11-6-8(12)13)7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,11)(H,12,13)

InChI key: InChIKey=ZDTNJTKQGYFSCI-UHFFFAOYSA-N

SMILES: C(NCC(O)=O)(=N)C1=CC=CC=C1

Synonyms:

• 2-([Imino(phenyl)methyl]amino)acetic acid
• N-(Iminophenylmethyl)glycine
• 2-Benzimidamidoacetic acid
• Glycine, N-(iminophenylmethyl)-
• Glycine, N-benzimidoyl-

2-Benzimidamidoacetic acid

CAS: 32683-07-1

Formula: C₉H₁₀N₂O₂

Molecular weight: 178.1879

Ref: IN-DA00C8VW