CAS 326831-74-7

4-Pyrimidinamine, 6-chloro-5-nitro-N-propyl-

Description:

4-Pyrimidinamine, 6-chloro-5-nitro-N-propyl- is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the 6-position and a nitro group at the 5-position contributes to its reactivity and potential biological activity. The N-propyl substituent at the 4-position enhances its lipophilicity, which may influence its pharmacokinetic properties. This compound is typically used in research and development, particularly in medicinal chemistry, where modifications to the pyrimidine core can lead to various therapeutic applications. Its molecular structure suggests potential interactions with biological targets, making it of interest in the study of drug design and development. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity or environmental impact.

Formula: C₇H₉ClN₄O₂

InChI: InChI=1S/C7H9ClN4O2/c1-2-3-9-7-5(12(13)14)6(8)10-4-11-7/h4H,2-3H2,1H3,(H,9,10,11)

InChI key: JAQFNGADDHFSFM-UHFFFAOYSA-N

SMILES: CCCNC1=C(C(=NC=N1)Cl)[N+](=O)[O-]

Synonyms:

• 6-Chloro-5-nitro-N-propylpyrimidin-4-amine
• 6-CHLORO-5-NITRO-N-PROPYL-4-PYRIMIDINAMINE
• IFLAB-BB F2124-0130
• 4-Pyrimidinamine, 6-chloro-5-nitro-N-propyl-

6-Chloro-5-nitro-N-propylpyrimidin-4-amine

CAS: 326831-74-7

Formula: C₇H₉ClN₄O₂

Molecular weight: 216.6250

Ref: IN-DA00CA5C