CymitQuimica logo

CAS 326867-81-6

:

5-Methyl-4-nitro-2-furancarboxylic acid

Description:
5-Methyl-4-nitro-2-furancarboxylic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a methyl group and a nitro group attached to the furan ring, as well as a carboxylic acid functional group. The presence of the nitro group contributes to its potential reactivity and polarity, while the carboxylic acid group imparts acidic properties. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit interesting biological activities, although specific studies would be necessary to elucidate its pharmacological properties. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest in both synthetic and applied chemistry. Safety data and handling precautions should be observed, as with any chemical substance, to ensure safe laboratory practices.
Formula:C6H5NO5
InChI:InChI=1S/C6H5NO5/c1-3-4(7(10)11)2-5(12-3)6(8)9/h2H,1H3,(H,8,9)
InChI key:LXJRLXXVMGGAGC-UHFFFAOYSA-N
SMILES:CC1=C(C=C(O1)C(=O)O)[N+](=O)[O-]
Synonyms:
  • 5-methyl-4-nitrofuran-2-carboxylic acid
  • 2-Furancarboxylic acid, 5-methyl-4-nitro-
  • 5-Methyl-4-nitro-2-furancarboxylic acid
Found 1 products.