CymitQuimica logo

CAS 326888-32-8

:

N1,N1,N2-triMethylethane-1,2-diaMine dihydrochloride

Description:
N1,N1,N2-trimethylethane-1,2-diamine dihydrochloride is a chemical compound characterized by its amine functional groups, specifically featuring two primary amine groups attached to a carbon chain. This compound is a derivative of ethane and is typically used in various chemical synthesis processes, particularly in the production of pharmaceuticals and agrochemicals. The presence of three methyl groups contributes to its steric hindrance, influencing its reactivity and solubility. As a dihydrochloride salt, it is usually more soluble in water compared to its free base form, which enhances its utility in aqueous applications. The compound's structure allows it to participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Safety data indicates that, like many amines, it may be irritating to the skin and eyes, necessitating appropriate handling precautions. Overall, N1,N1,N2-trimethylethane-1,2-diamine dihydrochloride is a versatile compound with significant applications in organic synthesis and industrial chemistry.
Formula:C5H16Cl2N2
InChI:InChI=1S/C5H14N2.2ClH/c1-6-4-5-7(2)3;;/h6H,4-5H2,1-3H3;2*1H
InChI key:JCPFKECTFKUEPV-UHFFFAOYSA-N
SMILES:CNCCN(C)C.Cl.Cl
Found 5 products.