CymitQuimica logo

CAS 326921-37-3

:

Phosphine oxide, bis[4-(1,1-dimethylethyl)phenyl]-

Description:
Phosphine oxide, bis[4-(1,1-dimethylethyl)phenyl]- is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to two bulky aryl groups, specifically 4-(1,1-dimethylethyl)phenyl groups. This structure imparts significant steric hindrance, which can influence its reactivity and stability. The compound typically exhibits properties associated with phosphine oxides, such as being a colorless to pale yellow solid with potential applications in organic synthesis and materials science. It is generally soluble in organic solvents, reflecting its non-polar characteristics due to the large hydrocarbon groups. The presence of the phosphine oxide functional group contributes to its potential as a ligand in coordination chemistry and as a precursor in the synthesis of various phosphorus-containing compounds. Safety data should be consulted for handling, as organophosphorus compounds can exhibit varying degrees of toxicity and environmental impact. Overall, the unique structural features of this compound make it of interest in both academic and industrial chemistry contexts.
Formula:C20H27OP
InChI:InChI=1S/C20H26OP/c1-19(2,3)15-7-11-17(12-8-15)22(21)18-13-9-16(10-14-18)20(4,5)6/h7-14H,1-6H3/q+1
InChI key:WLQIAVPVRXPZJA-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=CC=C(C=C1)[P+](=O)C2=CC=C(C=C2)C(C)(C)C
Synonyms:
  • bi(-(ert buty)pheny)phosphine oxide
  • dimethylethyl)phenyl]-Phosphine oxide
  • Phosphine oxide, bis[4-(1,1-dimethylethyl)phenyl]-
  • Bis(4-(tert-butyl)phenyl)phosphine oxide
  • bis[4-(1,1-
Found 4 products.