CymitQuimica logo

CAS 327-74-2

:

4-Amino-3-trifluoromethylbenzonitrile

Description:
4-Amino-3-trifluoromethylbenzonitrile, with the CAS number 327-74-2, is an organic compound characterized by the presence of an amino group (-NH2), a trifluoromethyl group (-CF3), and a nitrile group (-C≡N) attached to a benzene ring. This compound typically appears as a solid and is known for its aromatic properties due to the benzene structure. The trifluoromethyl group imparts unique electronic and steric characteristics, enhancing its reactivity and solubility in various organic solvents. The amino group can participate in hydrogen bonding, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the nitrile group contributes to the compound's polarity and can be involved in further functionalization. 4-Amino-3-trifluoromethylbenzonitrile is of interest in pharmaceutical and agrochemical research due to its potential biological activity and utility as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C8H5F3N2
InChI:InChI=1S/C8H5F3N2/c9-8(10,11)6-3-5(4-12)1-2-7(6)13/h1-3H,13H2
InChI key:MWLZJOBGDXBMBP-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C#N)C(F)(F)F)N
Synonyms:
  • 2-Amino-5-cyanobenzotrifluoride
  • 4-Amino-3-(trifluoromethyl)benzonitrile
  • 3-Trifluoromethyl-4-Aminobenzonitrile
  • 2-Trifluoromethyl-4-cyanoaniline
Found 9 products.