CymitQuimica logo

CAS 327-76-4

:

2,4-Bis(trifluoromethyl)chlorobenzene

Description:
2,4-Bis(trifluoromethyl)chlorobenzene is an aromatic compound characterized by the presence of two trifluoromethyl groups and one chlorine atom attached to a benzene ring. Its molecular structure contributes to its unique chemical properties, including high lipophilicity and thermal stability. The trifluoromethyl groups enhance the compound's electron-withdrawing characteristics, making it a potent candidate for various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature, and is known for its low volatility and high density. It is relatively insoluble in water but soluble in organic solvents, which makes it useful in various applications, including as a solvent or reagent in organic synthesis. Safety considerations are important when handling this compound, as it may pose environmental and health risks due to its fluorinated nature and potential toxicity. Proper precautions should be taken to minimize exposure and ensure safe handling in laboratory or industrial settings.
Formula:C8H3ClF6
InChI:InChI=1S/C8H3ClF6/c9-6-2-1-4(7(10,11)12)3-5(6)8(13,14)15/h1-3H
InChI key:XIVDTLKMHDHQCB-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)Cl
Found 4 products.