CymitQuimica logo

CAS 327-95-7

:

4-Fluoro-1,3-benzenedicarboxylic acid

Description:
4-Fluoro-1,3-benzenedicarboxylic acid, also known as 4-fluorophthalic acid, is an aromatic carboxylic acid characterized by the presence of two carboxyl (-COOH) groups and a fluorine atom attached to a benzene ring. Its molecular structure features a fluorine substituent at the para position relative to one of the carboxylic acid groups. This compound is typically a white crystalline solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the fluorine atom can influence the compound's reactivity and physical properties, such as melting and boiling points, compared to its non-fluorinated counterparts. 4-Fluoro-1,3-benzenedicarboxylic acid is used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, and other organic compounds. Its reactivity is largely attributed to the carboxylic acid functional groups, which can participate in various chemical reactions, including esterification and amidation.
Formula:C8H5FO4
InChI:InChI=1S/C8H5FO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=OPWLKVOLSUNGEI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C(O)=O)=CC=C1F
Synonyms:
  • 1,3-Benzenedicarboxylic acid, 4-fluoro-
  • 4-Fluoro-1,3-benzenedicarboxylic acid
  • NSC 50699
  • 4-Fluoroisophthalic acid
  • Isophthalic acid, 4-fluoro-
Found 5 products.