CymitQuimica logo

CAS 3270-89-1

:

β-Amino-2-thiophenepropanoic acid

Description:
β-Amino-2-thiophenepropanoic acid, with the CAS number 3270-89-1, is an organic compound characterized by the presence of both an amino group and a thiophene ring in its structure. This compound typically exhibits properties associated with amino acids, such as the ability to form zwitterions in solution due to the presence of both a carboxylic acid and an amino group. The thiophene ring contributes to its aromatic character, which can influence its reactivity and interactions with other molecules. β-Amino-2-thiophenepropanoic acid is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and role as a building block in the synthesis of more complex compounds. Its solubility in polar solvents and stability under standard conditions make it suitable for various applications, including research in drug development and biochemical studies. Overall, this compound exemplifies the intersection of amino acid functionality and heterocyclic chemistry.
Formula:C7H9NO2S
InChI:InChI=1S/C7H9NO2S/c8-5(4-7(9)10)6-2-1-3-11-6/h1-3,5H,4,8H2,(H,9,10)
InChI key:InChIKey=GYAYLYLPTPXESE-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(N)C1=CC=CS1
Synonyms:
  • β-Amino-2-thiophenepropanoic acid
  • 2-Thiophenepropionic acid, β-amino-, DL-
  • 2-Thiophenepropanoic acid, β-amino-, (±)-
  • β-(2-Thienyl)-DL-β-alanine
  • 2-Thiophenepropanoic acid, β-amino-
Found 2 products.