CymitQuimica logo

CAS 32701-75-0

:

(3,5-dimethyl-1H-pyrazol-4-yl)acetic acid

Description:
(3,5-Dimethyl-1H-pyrazol-4-yl)acetic acid is an organic compound characterized by its pyrazole ring structure, which features two methyl groups at the 3 and 5 positions and an acetic acid functional group at the 4 position. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. Its molecular structure contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of the pyrazole moiety may impart specific reactivity and interaction properties, which can be exploited in various chemical reactions or biological applications. Additionally, the compound may exhibit acidic properties due to the carboxylic acid group, influencing its behavior in different pH environments. Overall, (3,5-dimethyl-1H-pyrazol-4-yl)acetic acid is a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C7H10N2O2
InChI:InChI=1/C7H10N2O2/c1-4-6(3-7(10)11)5(2)9-8-4/h3H2,1-2H3,(H,8,9)(H,10,11)
InChI key:HHILOQLQBYEUTP-UHFFFAOYSA-N
SMILES:Cc1c(CC(=O)O)c(C)n[nH]1
Synonyms:
  • 1H-pyrazole-4-acetic acid, 3,5-dimethyl-
Found 1 products.