CAS 327026-99-3

6-Chloro-2,2-dimethyl-8-nitro-2H-1,4-benzoxazin-3(4H)-one

Description:

6-Chloro-2,2-dimethyl-8-nitro-2H-1,4-benzoxazin-3(4H)-one is a chemical compound characterized by its complex structure, which includes a benzoxazine ring, a nitro group, and a chloro substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many benzoxazine derivatives. The presence of the nitro group often imparts specific reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the chloro substituent can influence the compound's electronic properties and reactivity. This substance may be of interest in fields such as medicinal chemistry, agrochemicals, or materials science due to its unique structural features. Its synthesis and applications could be explored further in research contexts, particularly in the development of new compounds with desired biological or chemical activities. As with any chemical, safety precautions should be taken when handling this substance, considering its potential hazards associated with the nitro and chloro groups.

Formula: C₁₀H₉ClN₂O₄

InChI: InChI=1S/C10H9ClN2O4/c1-10(2)9(14)12-6-3-5(11)4-7(13(15)16)8(6)17-10/h3-4H,1-2H3,(H,12,14)

InChI key: InChIKey=AVXRBJYQNZEJFH-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(NC(=O)C(C)(C)O2)=CC(Cl)=C1

Synonyms:

• 2H-1,4-Benzoxazin-3(4H)-one, 6-chloro-2,2-dimethyl-8-nitro-
• 6-Chloro-2,2-dimethyl-8-nitro-2H-1,4-benzoxazin-3(4H)-one

6-Chloro-2,2-dimethyl-8-nitro-2H-1,4-benzoxazin-3(4H)-one

CAS: 327026-99-3

6-Chloro-2,2-dimethyl-8-nitro-2H-1,4-benzoxazin-3(4H)-one

Formula: C₁₀H₉ClN₂O₄

Purity: >95%

Molecular weight: 256.64

Ref: 54-OR1162772

6-Chloro-2,2-dimethyl-8-nitro-2H-1,4-benzoxazin-3(4H)-one

CAS: 327026-99-3

Formula: C₁₀H₉ClN₂O₄

Purity: 95%

Molecular weight: 256.6425

Ref: IN-DA01DD50