CymitQuimica logo

CAS 32705-91-2

:

Ethylenediaminedipropionic acid dihydrochloride

Description:
Ethylenediaminedipropionic acid dihydrochloride, with the CAS number 32705-91-2, is a chemical compound that belongs to the class of amino acids and is characterized by its dual functional groups, which include both amine and carboxylic acid functionalities. This compound is a derivative of ethylenediamine and is often utilized in various applications, including as a chelating agent in coordination chemistry and in the formulation of pharmaceuticals. It is typically encountered as a white crystalline solid, soluble in water due to its ionic nature, particularly in its dihydrochloride form. The presence of two propionic acid groups enhances its ability to form stable complexes with metal ions, making it valuable in analytical chemistry and biochemistry. Additionally, its structure allows for potential applications in drug delivery systems and as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H18Cl2N2O4
InChI:InChI=1/C8H16N2O4.2ClH/c11-7(12)1-3-9-5-6-10-4-2-8(13)14;;/h9-10H,1-6H2,(H,11,12)(H,13,14);2*1H
InChI key:GSRDLTQJRCGIQI-UHFFFAOYSA-N
SMILES:C(CNCCNCCC(=O)O)C(=O)O.Cl.Cl
Synonyms:
  • Ethylenediamine-N,N-dipropionic acid dihydrochloride
  • 3,3'-(Ethane-1,2-Diyldiimino)Dipropanoic Acid Dihydrochloride (Non-Preferred Name)
Found 3 products.