CymitQuimica logo

CAS 327156-95-6

:

2-[4-(tert-butoxycarbonylamino)cyclohexyl]acetic acid

Description:
2-[4-(tert-butoxycarbonylamino)cyclohexyl]acetic acid is a chemical compound characterized by its unique structure, which includes a cyclohexyl group and a tert-butoxycarbonyl (Boc) protecting group attached to an amino functional group. This compound typically exhibits properties associated with both carboxylic acids and amines, including the ability to form hydrogen bonds due to the presence of the carboxylic acid group. The tert-butoxycarbonyl group serves as a protective group for the amine, making it useful in synthetic organic chemistry for the selective modification of amino acids or peptides. The compound is likely to be soluble in organic solvents and may exhibit moderate solubility in water, depending on the pH. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drug candidates that require specific functional group modifications. Additionally, the presence of the cyclohexyl moiety may influence the compound's steric and electronic properties, impacting its reactivity and interactions in biological systems.
Formula:C13H23NO4
InChI:InChI=1/C13H23NO4/c1-13(2,3)18-12(17)14-10-6-4-9(5-7-10)8-11(15)16/h9-10H,4-8H2,1-3H3,(H,14,17)(H,15,16)/t9-,10+
InChI key:IHXBNSUFUFFBRL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1CCC(CC1)CC(=O)O
Found 6 products.