CymitQuimica logo

CAS 328406-65-1

:

2-methoxyethyl N-[(4-nitrophenoxy)carbonyl]-L-phenylalaninate

Description:
2-Methoxyethyl N-[(4-nitrophenoxy)carbonyl]-L-phenylalaninate is a chemical compound characterized by its complex structure, which includes an amino acid derivative, a methoxyethyl group, and a nitrophenoxycarbonyl moiety. This compound typically exhibits properties associated with both polar and nonpolar characteristics due to the presence of various functional groups. The methoxyethyl group contributes to its solubility in organic solvents, while the nitrophenyl group may impart specific reactivity and stability under certain conditions. The presence of the L-phenylalaninate structure suggests potential biological activity, as amino acid derivatives often play roles in biochemical processes. Additionally, the nitro group can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the design of prodrugs or targeted delivery systems due to its structural features.
Formula:C19H20N2O7
InChI:InChI=1/C19H20N2O7/c1-26-11-12-27-18(22)17(13-14-5-3-2-4-6-14)20-19(23)28-16-9-7-15(8-10-16)21(24)25/h2-10,17H,11-13H2,1H3,(H,20,23)/t17-/m0/s1
InChI key:ZSOUYIBYVUBOGT-KRWDZBQOSA-N
SMILES:COCCOC(=O)[C@H](Cc1ccccc1)N=C(O)Oc1ccc(cc1)N(=O)=O
Found 5 products.