CAS 32860-56-3
:6-O-Tosyl-α-cyclodextrin
Description:
6-O-Tosyl-α-cyclodextrin is a modified derivative of α-cyclodextrin, which is a cyclic oligosaccharide composed of six glucose units. The modification involves the introduction of a tosyl group at the 6-position of the glucose unit, enhancing its solubility and reactivity. This compound typically exhibits characteristics such as increased lipophilicity compared to unmodified α-cyclodextrin, allowing it to form inclusion complexes with various hydrophobic guest molecules. It is often utilized in pharmaceutical applications for drug delivery and formulation, as it can improve the solubility and stability of poorly soluble drugs. Additionally, 6-O-tosyl-α-cyclodextrin can serve as a chiral selector in chromatography and as a reagent in organic synthesis. Its ability to form host-guest complexes makes it valuable in various fields, including materials science and biochemistry. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C43H66O32S
InChI:InChI=1S/C43H66O32S/c1-12-2-4-13(5-3-12)76(61,62)63-11-19-37-25(54)31(60)43(69-19)74-36-18(10-48)67-41(29(58)23(36)52)72-34-16(8-46)65-39(27(56)21(34)50)70-32-14(6-44)64-38(26(55)20(32)49)71-33-15(7-45)66-40(28(57)22(33)51)73-35-17(9-47)68-42(75-37)30(59)24(35)53/h2-5,14-60H,6-11H2,1H3/t14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-/m1/s1
InChI key:InChIKey=ARQITQMHQNGIEE-FUPLYMQKSA-N
SMILES:C(OS(=O)(=O)C1=CC=C(C)C=C1)[C@@H]2[C@]3(O[C@]4(O[C@H](CO)[C@]([C@H](O)[C@H]4O)(O[C@]5(O[C@H](CO)[C@]([C@H](O)[C@H]5O)(O[C@]6(O[C@H](CO)[C@@](O[C@]7(O[C@H](CO)[C@@](O[C@]8(O[C@H](CO)[C@@](O[C@@](O2)([C@H](O)[C@H]3O)[H])([C@H](O)[C@H]8O)[H])[H])([C@H](O)[C@H]7O)[H])[H])([C@H](O)[C@H]6O)[H])[H])[H])[H])[H])[H])[H]
Synonyms:- α-Cyclodextrin, 6A-(4-methylbenzenesulfonate)
- 2,4,7,9,12,14,17,19,22,24,27,29-Dodecaoxaheptacyclo[26.2.2.23,6.28,11.213,16.218,21.223,26]dotetracontane, α-cyclodextrin deriv.
- α-Cyclodextrin, 6-p-toluenesulfonate
- Mono-6-O-p-toluenesulfonyl-α-cyclodextrin
- 6-O-Tosyl-α-cyclodextrin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Mono-6-O-(p-toluenesulfonyl)-α-cyclodextrin
CAS:Formula:C43H66O32SPurity:>85.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,127.03Mono-6-O-(p-toluenesulfonyl)-α-cyclodextrin
CAS:Mono-6-O-(p-toluenesulfonyl)-α-cyclodextrinFormula:C43H66O32SPurity:>85.0%Molecular weight:1127.03Mono-6-O-(p-toluenesulfonyl)-α-cyclodextrin
CAS:Formula:C43H66O32SPurity:85.0%Color and Shape:SolidMolecular weight:1127.0299Mono-6-O-(p-toluenesulfonyl)-a-cyclodextrin
CAS:Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.Formula:C43H66O32SPurity:Min. 95%Color and Shape:White PowderMolecular weight:1,127.03 g/mol



