CymitQuimica logo

CAS 32863-30-2

:

4-(Bromomethyl)-2,1,3-benzoxadiazole

Description:
4-(Bromomethyl)-2,1,3-benzoxadiazole is an organic compound characterized by its unique structure, which includes a benzoxadiazole moiety and a bromomethyl group. This compound typically appears as a solid and is known for its potential applications in various fields, including materials science and organic synthesis. The presence of the bromomethyl group enhances its reactivity, making it a useful intermediate in the synthesis of other chemical entities. The benzoxadiazole framework contributes to its electronic properties, which can be exploited in the development of fluorescent materials or as a building block in the synthesis of pharmaceuticals. Additionally, this compound may exhibit interesting photophysical properties, making it a candidate for studies in photochemistry and photophysics. Safety considerations should be taken into account when handling this compound, as it may pose health risks due to the presence of bromine and its reactivity. Overall, 4-(Bromomethyl)-2,1,3-benzoxadiazole is a versatile compound with significant potential in chemical research and applications.
Formula:C7H5BrN2O
InChI:InChI=1/C7H5BrN2O/c8-4-5-2-1-3-6-7(5)10-11-9-6/h1-3H,4H2
InChI key:OFUZQEBZOGPUBJ-UHFFFAOYSA-N
SMILES:c1cc(CBr)c2c(c1)non2
Found 3 products.