CymitQuimica logo

CAS 32871-20-8

:

1,4:3,6-dianhydro-2-O-hexopyranuronosyl-5-O-nitro-D-glucitol

Description:
1,4:3,6-Dianhydro-2-O-hexopyranuronosyl-5-O-nitro-D-glucitol, with the CAS number 32871-20-8, is a complex organic compound characterized by its unique structural features that include multiple functional groups. This substance is a derivative of glucitol, which is a sugar alcohol, and incorporates both an anhydro sugar structure and a nitro group. The presence of the nitro group suggests potential reactivity, particularly in electrophilic substitution reactions. The compound's anhydro configuration indicates that it has undergone dehydration, resulting in a cyclic structure that can influence its solubility and reactivity. Additionally, the hexopyranuronosyl moiety suggests that it may participate in biological processes, possibly as a glycosyl donor or acceptor. Its specific stereochemistry and functional groups may also impart unique properties, such as altered polarity and hydrogen bonding capabilities, which can affect its interactions in various chemical environments. Overall, this compound's intricate structure positions it as a potentially interesting subject for further research in organic chemistry and biochemistry.
Formula:C12H17NO12
InChI:InChI=1/C12H17NO12/c14-5-6(15)10(11(17)18)24-12(7(5)16)23-3-1-21-9-4(25-13(19)20)2-22-8(3)9/h3-10,12,14-16H,1-2H2,(H,17,18)/t3-,4+,5?,6?,7?,8+,9+,10?,12?/m0/s1
InChI key:MQHSDQNPAIOBOQ-KUIJWGRUSA-N
SMILES:C1[C@@H]([C@@H]2[C@H](O1)[C@@H](CO2)O[N+](=O)[O-])OC3C(C(C(C(O3)C(=O)O)O)O)O
Found 4 products.