CymitQuimica logo

CAS 329210-07-3

:

ethyl 3-amino-5-chloro-1-benzofuran-2-carboxylate

Description:
Ethyl 3-amino-5-chloro-1-benzofuran-2-carboxylate is a chemical compound characterized by its unique structure, which includes a benzofuran moiety, an amino group, and a chloro substituent. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents, reflecting its moderate polarity due to the presence of both hydrophobic and hydrophilic functional groups. The amino group can participate in hydrogen bonding, enhancing its reactivity and potential interactions with biological systems. The chloro substituent may influence the compound's electronic properties and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Ethyl 3-amino-5-chloro-1-benzofuran-2-carboxylate may also exhibit biological activity, which could be of interest in medicinal chemistry and drug development. Its specific applications and behavior in biological systems would depend on further studies, including pharmacokinetics and toxicity assessments. Overall, this compound represents a versatile structure with potential implications in both synthetic and medicinal chemistry.
Formula:C11H10ClNO3
InChI:InChI=1S/C11H10ClNO3/c1-2-15-11(14)10-9(13)7-5-6(12)3-4-8(7)16-10/h3-5H,2,13H2,1H3
InChI key:VKKDUUXDTANQAJ-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(C2=C(O1)C=CC(=C2)Cl)N
Synonyms:
  • Ethyl 3-Amino-5-Chlorobenzo[D]Furan-2-Carboxylate
  • 3-Amino-5-chloro-benzofuran-2-carboxylic acid ethyl ester
  • Ethyl 3-Amino-5-Chlorobenzofuran-2-Carboxylate
Found 3 products.