CymitQuimica logo

CAS 329306-27-6

:

3-(carbamoylamino)-2-[(2,4-dichlorophenyl)carbonyl]-1-benzofuran-6-yl methanesulfonate

Description:
3-(Carbamoylamino)-2-[(2,4-dichlorophenyl)carbonyl]-1-benzofuran-6-yl methanesulfonate, with the CAS number 329306-27-6, is a synthetic organic compound characterized by its complex structure, which includes a benzofuran moiety, a carbamoylamino group, and a methanesulfonate functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the dichlorophenyl group suggests that it may have significant interactions with biological targets, potentially influencing its pharmacological properties. Additionally, the methanesulfonate group can enhance solubility and stability, making it suitable for various applications in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like crystallization or chromatography. Overall, this compound may be of interest in drug development or as a biochemical probe, although specific biological activities and applications would require further investigation through empirical studies.
Formula:C17H12Cl2N2O6S
InChI:InChI=1/C17H12Cl2N2O6S/c1-28(24,25)27-9-3-5-11-13(7-9)26-16(14(11)21-17(20)23)15(22)10-4-2-8(18)6-12(10)19/h2-7H,1H3,(H3,20,21,23)
InChI key:YPFLFUJKZDAXRA-UHFFFAOYSA-N
SMILES:CS(=O)(=O)Oc1ccc2c(c1)oc(c2NC(=N)O)C(=O)c1ccc(cc1Cl)Cl
Found 4 products.