CAS 329908-47-6
:Benzoic acid, 2-methyl-5-(1-piperidinylsulfonyl)-
Description:
Benzoic acid, 2-methyl-5-(1-piperidinylsulfonyl)-, also known by its CAS number 329908-47-6, is a chemical compound characterized by its benzoic acid core structure, which is substituted with a methyl group and a piperidinylsulfonyl group. This compound typically exhibits properties associated with both aromatic carboxylic acids and sulfonamides, including moderate solubility in polar solvents and potential for hydrogen bonding due to the carboxylic acid functional group. The presence of the piperidine ring contributes to its basicity and may influence its biological activity, making it of interest in pharmaceutical research. The sulfonyl group enhances the compound's reactivity and can participate in various chemical reactions, such as nucleophilic substitutions. Overall, this compound's unique structure may confer specific pharmacological properties, making it a candidate for further investigation in medicinal chemistry.
Formula:C13H17NO4S
InChI:InChI=1S/C13H17NO4S/c1-10-5-6-11(9-12(10)13(15)16)19(17,18)14-7-3-2-4-8-14/h5-6,9H,2-4,7-8H2,1H3,(H,15,16)
InChI key:VWAYHOTULMZDBG-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=C1)S(=O)(=O)N2CCCCC2)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
