CymitQuimica logo

CAS 330555-71-0

:

ethyl 3-amino-5-bromo-1-benzofuran-2-carboxylate

Description:
Ethyl 3-amino-5-bromo-1-benzofuran-2-carboxylate is a chemical compound characterized by its unique structure, which includes a benzofuran moiety, an amino group, and a bromo substituent. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the amino group suggests potential for hydrogen bonding and reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The bromo substituent can serve as a site for further functionalization, making it a versatile intermediate in organic synthesis. Additionally, the benzofuran structure imparts certain biological activities, which may be of interest in medicinal chemistry. The compound's molecular properties, such as melting point, boiling point, and solubility, would depend on its specific interactions with solvents and other reagents. Overall, ethyl 3-amino-5-bromo-1-benzofuran-2-carboxylate is a compound of interest for research in organic synthesis and potential pharmaceutical applications.
Formula:C11H10BrNO3
InChI:InChI=1S/C11H10BrNO3/c1-2-15-11(14)10-9(13)7-5-6(12)3-4-8(7)16-10/h3-5H,2,13H2,1H3
InChI key:NPRPLFNZHAIWEC-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(C2=C(O1)C=CC(=C2)Br)N
Synonyms:
  • Ethyl 3-amino-5-bromobenzofuran-2-carboxylate
  • Ethyl 3-Amino-5-Bromobenzo[D]Furan-2-Carboxylate
  • 3-Amino-5-bromo-benzofuran-2-carboxylic acid ethyl ester
  • Ethyl 5-Bromo-3-Amino-2-Benzofurancarboxylate
Found 4 products.