CAS 331-62-4
:3-Fluoro-4-methoxybenzonitrile
Description:
3-Fluoro-4-methoxybenzonitrile, with the CAS number 331-62-4, is an aromatic compound characterized by the presence of a fluorine atom and a methoxy group attached to a benzene ring that also contains a nitrile functional group. This compound typically exhibits a white to light yellow crystalline appearance. The fluorine atom contributes to its unique electronic properties, potentially enhancing its reactivity and influencing its interactions with other molecules. The methoxy group (-OCH3) is known for its electron-donating effects, which can stabilize the aromatic ring and affect the compound's overall polarity. The nitrile group (-C≡N) is a strong electron-withdrawing group, which can impart significant acidity to adjacent hydrogen atoms and influence the compound's solubility in various solvents. 3-Fluoro-4-methoxybenzonitrile is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals, owing to its functional groups that allow for further chemical modifications.
Formula:C8H6FNO
InChI:InChI=1S/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3
InChI key:InChIKey=FEEOVAOEPGQDTJ-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(F)=C(OC)C=C1
Synonyms:- 4-Methoxy-3-fluorobenzonitrile
- Benzonitrile, 3-fluoro-4-methoxy-
- Fluoromethoxybenzonitrile
- p-Anisonitrile, 3-fluoro-
- 3-Fluoro-4-methoxybenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Fluoro-4-methoxybenzonitrile
CAS:Formula:C8H6FNOPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:151.143-Fluoro-4-methoxybenzonitrile
CAS:3-Fluoro-4-methoxybenzonitrileFormula:C8H6FNOPurity:98%Color and Shape:White Solid-PowderMolecular weight:151.137743-Fluoro-4-methoxybenzonitrile
CAS:Formula:C8H6FNOPurity:96%Color and Shape:SolidMolecular weight:151.13773-Fluoro-4-methoxybenzonitrile
CAS:3-Fluoro-4-methoxybenzonitrile is a ferroelectric liquid crystal chiral molecule. It can be synthesized industrially by the reaction of 3-fluoro-4-methoxybenzoyl chloride with sodium methoxide. The synthesis is scalable and leads to high yields. 3-Fluoro-4-methoxybenzonitrile has been used in the synthesis of other ferroelectric liquid crystals, such as 4-(3′,5′-diiodophenyl)pentaerythritol triacrylate and 3,5′-(1H,1′H) -dibenzothiophene. This compound also displays nematic phase behavior at room temperature when in contact with a nematic director. Polarization data for this substance are available from experiments on thin films.Formula:C8H6FNOPurity:Min. 95%Color and Shape:PowderMolecular weight:151.14 g/mol3-Fluoro-4-methoxybenzonitrile
CAS:3-Fluoro-4-methoxybenzonitrileFormula:C8H6FNOPurity:96%Molecular weight:151.143-Fluoro-4-methoxybenzonitile
CAS:Formula:C8H6FNOPurity:97.0%Color and Shape:SolidMolecular weight:151.14






