CAS 33109-58-9
:Butanedioic acid, 1,4-bis(4-nitrophenyl) ester
Description:
Butanedioic acid, 1,4-bis(4-nitrophenyl) ester, also known as bis(4-nitrophenyl) succinate, is an organic compound characterized by its ester functional groups derived from butanedioic acid (succinic acid) and 4-nitrophenol. This compound typically appears as a yellow crystalline solid due to the presence of nitro groups, which can influence its color and reactivity. It is known for its moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic nature. The nitrophenyl groups contribute to its potential applications in various fields, including organic synthesis and materials science, particularly in the development of polymers and as intermediates in chemical reactions. The presence of nitro groups also imparts unique electronic properties, making it a candidate for studies in electronic materials. However, safety precautions should be taken when handling this compound, as nitro compounds can be hazardous and may pose environmental risks.
Formula:C16H12N2O8
InChI:InChI=1S/C16H12N2O8/c19-15(25-13-5-1-11(2-6-13)17(21)22)9-10-16(20)26-14-7-3-12(4-8-14)18(23)24/h1-8H,9-10H2
InChI key:HKJFYVRDQXGPPK-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1[N+](=O)[O-])OC(=O)CCC(=O)OC2=CC=C(C=C2)[N+](=O)[O-]
Synonyms:- Bis-(4-nitrophenyl)succinate
- Butanedioic acid, 1,4-bis(4-nitrophenyl) ester
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
