CAS 33119-72-1
:1-Amino-3,3-dimethyl-2-butanone hydrochloride
Description:
1-Amino-3,3-dimethyl-2-butanone hydrochloride is an organic compound characterized by its amine and ketone functional groups. It features a branched alkyl structure, which contributes to its unique chemical properties. The presence of the amino group (-NH2) indicates that it can participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The hydrochloride form suggests that the compound is a salt, which enhances its solubility in water and makes it more stable in certain conditions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of compounds with biological activity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C6H13NO·ClH
InChI:InChI=1S/C6H13NO.ClH/c1-6(2,3)5(8)4-7;/h4,7H2,1-3H3;1H
InChI key:InChIKey=HDVFPYCWYCXEKW-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(CN)=O.Cl
Synonyms:- 1-Amino-3,3-Dimethyl-Butan-2-One Hcl
- 1-Amino-3,3-Dimethyl-Butan-2-One Hydrochloride
- 1-Amino-3,3-Dimethylbutan-2-One
- 1-Amino-3,3-dimethyl-2-butanonehydrochloride
- 2-Butanone, 1-amino-3,3-dimethyl-, hydrochloride
- 2-Butanone, 1-amino-3,3-dimethyl-, hydrochloride (1:1)
- α-Aminopinacolone hydrochloride
- 1-Amino-3,3-dimethyl-2-butanone hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Butanone, 1-amino-3,3-dimethyl-, hydrochloride (1:1)
CAS:Formula:C6H14ClNOPurity:97%Color and Shape:SolidMolecular weight:151.63451-Amino-3,3-dimethyl-butan-2-one hydrochloride
CAS:1-Amino-3,3-dimethyl-butan-2-one hydrochlorideFormula:C6H13NO·ClHPurity:98%Molecular weight:151.634451-Amino-3,3-dimethylbutan-2-one hydrochloride
CAS:1-Amino-3,3-dimethylbutan-2-one hydrochlorideFormula:C6H14ClNOPurity:98%Molecular weight:151.631-Amino-3,3-dimethyl-butan-2-one hydrochloride
CAS:Formula:C6H14ClNOPurity:97%Color and Shape:SolidMolecular weight:151.631-Amino-3,3-dimethyl-butan-2-one hydrochloride
CAS:1-Amino-3,3-dimethyl-butan-2-one hydrochloride is a carboxamide that inhibits the cyclin-dependent kinases (CDKs) and is used to treat immune diseases. It has been shown to inhibit the production of nitric oxide by inhibiting the enzyme nitric oxide synthase. 1-Amino-3,3-dimethyl-butan-2-one hydrochloride also inhibits the activity of kinases that are important for cell division and proliferation. This drug was also found to have anti cancer properties as it prevents cells from dividing. The drug binds to an aromatic ring system in proteins and blocks the activity of enzymes that are responsible for protein synthesis.Formula:C6H14ClNOPurity:Min. 95%Molecular weight:151.63 g/mol




