CymitQuimica logo

CAS 331852-66-5

:

2-hydroxy-3-[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-6-methyl-4H-pyran-4-one

Description:
2-hydroxy-3-[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-6-methyl-4H-pyran-4-one, with the CAS number 331852-66-5, is a complex organic compound characterized by its pyranone structure, which features a six-membered ring containing both oxygen and carbon atoms. This compound exhibits a range of functional groups, including hydroxyl (-OH) and methoxy (-OCH3) groups, contributing to its potential biological activity. The presence of the enoyl moiety suggests that it may participate in various chemical reactions, such as Michael additions or conjugate additions. Its structural features indicate potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its possible antioxidant or anti-inflammatory properties. The compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic ring and the pyranone core, making it a subject of interest for further research in organic synthesis and drug development.
Formula:C17H16O7
InChI:InChI=1/C17H16O7/c1-9-6-12(19)15(17(21)24-9)11(18)5-4-10-7-13(22-2)16(20)14(8-10)23-3/h4-8,20-21H,1-3H3/b5-4+
InChI key:NCXJIWTVFHYSKF-SNAWJCMRSA-N
SMILES:CC1=CC(=C(C(=O)O1)C(=O)/C=C/C2=CC(=C(C(=C2)OC)O)OC)O
Found 2 products.